C11H15BrClNO2 — CID 175415632
2-(4-bromo-2-methoxyphenyl)-N-ethylacetamide;hydrochloride (PubChem CID 175415632) has the molecular formula C11H15BrClNO2 and a molecular weight of 308.60 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxyphenyl)-N-ethylacetamide;hydrochloride.
| Compound Name | 2-(4-bromo-2-methoxyphenyl)-N-ethylacetamide;hydrochloride |
|---|---|
| PubChem CID | 175415632 |
| Molecular Formula | C11H15BrClNO2 |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 2-(4-bromo-2-methoxyphenyl)-N-ethylacetamide;hydrochloride |
| SMILES | CCNC(=O)Cc1ccc(Br)cc1OC.Cl |
| InChI | InChI=1S/C11H14BrNO2.ClH/c1-3-13-11(14)6-8-4-5-9(12)7-10(8)15-2;/h4-5,7H,3,6H2,1-2H3,(H,13,14);1H |
| InChIKey | JIJSFXOWHKNGLE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |