C13H15BrF3NO2 — CID 156905176
[4-bromo-2-(trifluoromethyl)phenyl]methyl N-tert-butylcarbamate (PubChem CID 156905176) has the molecular formula C13H15BrF3NO2 and a molecular weight of 354.17 g/mol. Its IUPAC name is [4-bromo-2-(trifluoromethyl)phenyl]methyl N-tert-butylcarbamate.
| Compound Name | [4-bromo-2-(trifluoromethyl)phenyl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 156905176 |
| Molecular Formula | C13H15BrF3NO2 |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | [4-bromo-2-(trifluoromethyl)phenyl]methyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO2/c1-12(2,3)18-11(19)20-7-8-4-5-9(14)6-10(8)13(15,16)17/h4-6H,7H2,1-3H3,(H,18,19) |
| InChIKey | UKRBMGJGXURQJX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |