C9H7BrF3NO2 — CID 103925205
4-bromo-N-methoxy-2-(trifluoromethyl)benzamide (PubChem CID 103925205) has the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. Its IUPAC name is 4-bromo-N-methoxy-2-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-methoxy-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103925205 |
| Molecular Formula | C9H7BrF3NO2 |
| Molecular Weight | 298.06 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 4-bromo-N-methoxy-2-(trifluoromethyl)benzamide |
| SMILES | CONC(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C9H7BrF3NO2/c1-16-14-8(15)6-3-2-5(10)4-7(6)9(11,12)13/h2-4H,1H3,(H,14,15) |
| InChIKey | NGBTVMSIAAAPNT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.06 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|