C14H18BrF3N2O — CID 107333139
N-[3-(aminomethyl)pentan-3-yl]-4-bromo-2-(trifluoromethyl)benzamide (PubChem CID 107333139) has the molecular formula C14H18BrF3N2O and a molecular weight of 367.21 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-4-bromo-2-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-4-bromo-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 107333139 |
| Molecular Formula | C14H18BrF3N2O |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-4-bromo-2-(trifluoromethyl)benzamide |
| SMILES | CCC(CC)(CN)NC(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18BrF3N2O/c1-3-13(4-2,8-19)20-12(21)10-6-5-9(15)7-11(10)14(16,17)18/h5-7H,3-4,8,19H2,1-2H3,(H,20,21) |
| InChIKey | QPFSUQYJHMGOAY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |