C12H14BrF3N2O — CID 107333127
N-(3-aminobutyl)-4-bromo-2-(trifluoromethyl)benzamide (PubChem CID 107333127) has the molecular formula C12H14BrF3N2O and a molecular weight of 339.16 g/mol. Its IUPAC name is N-(3-aminobutyl)-4-bromo-2-(trifluoromethyl)benzamide.
| Compound Name | N-(3-aminobutyl)-4-bromo-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 107333127 |
| Molecular Formula | C12H14BrF3N2O |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-(3-aminobutyl)-4-bromo-2-(trifluoromethyl)benzamide |
| SMILES | CC(N)CCNC(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C12H14BrF3N2O/c1-7(17)4-5-18-11(19)9-3-2-8(13)6-10(9)12(14,15)16/h2-3,6-7H,4-5,17H2,1H3,(H,18,19) |
| InChIKey | OXHCWOMIMVUXDS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |