C14H16BrClF3NO — CID 107333565
4-bromo-N-(4-chloro-2-ethylbutyl)-2-(trifluoromethyl)benzamide (PubChem CID 107333565) has the molecular formula C14H16BrClF3NO and a molecular weight of 386.64 g/mol. Its IUPAC name is 4-bromo-N-(4-chloro-2-ethylbutyl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(4-chloro-2-ethylbutyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 107333565 |
| Molecular Formula | C14H16BrClF3NO |
| Molecular Weight | 386.64 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 4-bromo-N-(4-chloro-2-ethylbutyl)-2-(trifluoromethyl)benzamide |
| SMILES | CCC(CCCl)CNC(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H16BrClF3NO/c1-2-9(5-6-16)8-20-13(21)11-4-3-10(15)7-12(11)14(17,18)19/h3-4,7,9H,2,5-6,8H2,1H3,(H,20,21) |
| InChIKey | KQJJAMXQKAMJEA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|