C14H17BrF3NO2 — CID 103925383
4-bromo-N-(6-hydroxyhexyl)-2-(trifluoromethyl)benzamide (PubChem CID 103925383) has the molecular formula C14H17BrF3NO2 and a molecular weight of 368.19 g/mol. Its IUPAC name is 4-bromo-N-(6-hydroxyhexyl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(6-hydroxyhexyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103925383 |
| Molecular Formula | C14H17BrF3NO2 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 4-bromo-N-(6-hydroxyhexyl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCCCCCO)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17BrF3NO2/c15-10-5-6-11(12(9-10)14(16,17)18)13(21)19-7-3-1-2-4-8-20/h5-6,9,20H,1-4,7-8H2,(H,19,21) |
| InChIKey | XIHUJXVBPIFWMP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|