C14H15BrF3NO2 — CID 103925091
4-bromo-N-(2-but-3-enoxyethyl)-2-(trifluoromethyl)benzamide (PubChem CID 103925091) has the molecular formula C14H15BrF3NO2 and a molecular weight of 366.18 g/mol. Its IUPAC name is 4-bromo-N-(2-but-3-enoxyethyl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(2-but-3-enoxyethyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103925091 |
| Molecular Formula | C14H15BrF3NO2 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 4-bromo-N-(2-but-3-enoxyethyl)-2-(trifluoromethyl)benzamide |
| SMILES | C=CCCOCCNC(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H15BrF3NO2/c1-2-3-7-21-8-6-19-13(20)11-5-4-10(15)9-12(11)14(16,17)18/h2,4-5,9H,1,3,6-8H2,(H,19,20) |
| InChIKey | STVGZWMCCVJKCH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|