C14H18BrNO2 — CID 103855682
5-bromo-N-(2-but-3-enoxyethyl)-2-methylbenzamide (PubChem CID 103855682) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 5-bromo-N-(2-but-3-enoxyethyl)-2-methylbenzamide.
| Compound Name | 5-bromo-N-(2-but-3-enoxyethyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 103855682 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 5-bromo-N-(2-but-3-enoxyethyl)-2-methylbenzamide |
| SMILES | C=CCCOCCNC(=O)c1cc(Br)ccc1C |
| InChI | InChI=1S/C14H18BrNO2/c1-3-4-8-18-9-7-16-14(17)13-10-12(15)6-5-11(13)2/h3,5-6,10H,1,4,7-9H2,2H3,(H,16,17) |
| InChIKey | OTBAONPJDFJROZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|