C13H15BrF3NO2 — CID 103925342
4-bromo-N-(4-hydroxy-3-methylbutan-2-yl)-2-(trifluoromethyl)benzamide (PubChem CID 103925342) has the molecular formula C13H15BrF3NO2 and a molecular weight of 354.17 g/mol. Its IUPAC name is 4-bromo-N-(4-hydroxy-3-methylbutan-2-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(4-hydroxy-3-methylbutan-2-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103925342 |
| Molecular Formula | C13H15BrF3NO2 |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 4-bromo-N-(4-hydroxy-3-methylbutan-2-yl)-2-(trifluoromethyl)benzamide |
| SMILES | CC(CO)C(C)NC(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO2/c1-7(6-19)8(2)18-12(20)10-4-3-9(14)5-11(10)13(15,16)17/h3-5,7-8,19H,6H2,1-2H3,(H,18,20) |
| InChIKey | UEAFLPWJAMBVTO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |