C13H15BrF3NO3 — CID 107332843
4-bromo-N-(1,1-dimethoxypropan-2-yl)-2-(trifluoromethyl)benzamide (PubChem CID 107332843) has the molecular formula C13H15BrF3NO3 and a molecular weight of 370.17 g/mol. Its IUPAC name is 4-bromo-N-(1,1-dimethoxypropan-2-yl)-2-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(1,1-dimethoxypropan-2-yl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 107332843 |
| Molecular Formula | C13H15BrF3NO3 |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 4-bromo-N-(1,1-dimethoxypropan-2-yl)-2-(trifluoromethyl)benzamide |
| SMILES | COC(OC)C(C)NC(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO3/c1-7(12(20-2)21-3)18-11(19)9-5-4-8(14)6-10(9)13(15,16)17/h4-7,12H,1-3H3,(H,18,19) |
| InChIKey | FRUUQIDJFRHJDN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|