C12H15BrFNO3 — CID 107951282
3-bromo-N-(1,1-dimethoxypropan-2-yl)-2-fluorobenzamide (PubChem CID 107951282) has the molecular formula C12H15BrFNO3 and a molecular weight of 320.16 g/mol. Its IUPAC name is 3-bromo-N-(1,1-dimethoxypropan-2-yl)-2-fluorobenzamide.
| Compound Name | 3-bromo-N-(1,1-dimethoxypropan-2-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 107951282 |
| Molecular Formula | C12H15BrFNO3 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 3-bromo-N-(1,1-dimethoxypropan-2-yl)-2-fluorobenzamide |
| SMILES | COC(OC)C(C)NC(=O)c1cccc(Br)c1F |
| InChI | InChI=1S/C12H15BrFNO3/c1-7(12(17-2)18-3)15-11(16)8-5-4-6-9(13)10(8)14/h4-7,12H,1-3H3,(H,15,16) |
| InChIKey | REUIHHRCWMZLIU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|