C12H15Br2NO3 — CID 107939092
2,4-dibromo-N-(1,1-dimethoxypropan-2-yl)benzamide (PubChem CID 107939092) has the molecular formula C12H15Br2NO3 and a molecular weight of 381.06 g/mol. Its IUPAC name is 2,4-dibromo-N-(1,1-dimethoxypropan-2-yl)benzamide.
| Compound Name | 2,4-dibromo-N-(1,1-dimethoxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 107939092 |
| Molecular Formula | C12H15Br2NO3 |
| Molecular Weight | 381.06 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | 2,4-dibromo-N-(1,1-dimethoxypropan-2-yl)benzamide |
| SMILES | COC(OC)C(C)NC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H15Br2NO3/c1-7(12(17-2)18-3)15-11(16)9-5-4-8(13)6-10(9)14/h4-7,12H,1-3H3,(H,15,16) |
| InChIKey | WHBIRKYHCYTEMF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.06 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|