3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid

C10H6BrF5O2 — CID 162738234

IUPAC3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid
SMILESO=C(O)C(F)(F)Cc1ccc(Br)cc1C(F)(F)F
InChIInChI=1S/C10H6BrF5O2/c11-6-2-1-5(4-9(12,13)8(17)18)7(3-6)10(14,15)16/h1-3H,4H2,(H,17,18)
InChIKeyIPYAOQXDYFATIB-UHFFFAOYSA-N
MW333.05 g/mol
LogP3.73
Rot. Bonds3

About 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid

3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid (PubChem CID 162738234) has the molecular formula C10H6BrF5O2 and a molecular weight of 333.05 g/mol. Its IUPAC name is 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid.

Molecular Properties

Compound Name3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid
PubChem CID162738234
Molecular FormulaC10H6BrF5O2
Molecular Weight333.05 g/mol
Exact Mass331.95
IUPAC Name3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid
SMILESO=C(O)C(F)(F)Cc1ccc(Br)cc1C(F)(F)F
InChIInChI=1S/C10H6BrF5O2/c11-6-2-1-5(4-9(12,13)8(17)18)7(3-6)10(14,15)16/h1-3H,4H2,(H,17,18)
InChIKeyIPYAOQXDYFATIB-UHFFFAOYSA-N
XLogP3.73
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.05
LogP ≤ 53.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid?
The IUPAC name of 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid (CID 162738234) is 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid.
What is the SMILES notation for 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid?
The canonical SMILES for 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid is O=C(O)C(F)(F)Cc1ccc(Br)cc1C(F)(F)F.
What is the InChIKey of 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid?
The InChIKey is IPYAOQXDYFATIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrF5O2/c11-6-2-1-5(4-9(12,13)8(17)18)7(3-6)10(14,15)16/h1-3H,4H2,(H,17,18).
What are the key properties of 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid?
3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid has a molecular weight of 333.05 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-bromo-2-(trifluoromethyl)phenyl]-2,2-difluoropropanoic acid is sourced from PubChem (CID 162738234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).