C8H5BrF3O2S- — CID 174373945
[4-bromo-2-(trifluoromethyl)phenyl]methanesulfinate (PubChem CID 174373945) has the molecular formula C8H5BrF3O2S- and a molecular weight of 302.09 g/mol. Its IUPAC name is [4-bromo-2-(trifluoromethyl)phenyl]methanesulfinate.
| Compound Name | [4-bromo-2-(trifluoromethyl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174373945 |
| Molecular Formula | C8H5BrF3O2S- |
| Molecular Weight | 302.09 g/mol |
| Exact Mass | 300.92 |
| IUPAC Name | [4-bromo-2-(trifluoromethyl)phenyl]methanesulfinate |
| SMILES | O=S([O-])Cc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C8H6BrF3O2S/c9-6-2-1-5(4-15(13)14)7(3-6)8(10,11)12/h1-3H,4H2,(H,13,14)/p-1 |
| InChIKey | NREULDIWQBCHQG-UHFFFAOYSA-M |
| XLogP | 2.85 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.09 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|