C14H17BF3O4S- — CID 174761191
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methanesulfinate (PubChem CID 174761191) has the molecular formula C14H17BF3O4S- and a molecular weight of 349.16 g/mol. Its IUPAC name is [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methanesulfinate.
| Compound Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174761191 |
| Molecular Formula | C14H17BF3O4S- |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methanesulfinate |
| SMILES | CC1(C)OB(c2ccc(CS(=O)[O-])c(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C14H18BF3O4S/c1-12(2)13(3,4)22-15(21-12)10-6-5-9(8-23(19)20)11(7-10)14(16,17)18/h5-7H,8H2,1-4H3,(H,19,20)/p-1 |
| InChIKey | MTVADUDXYWQLRD-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|