C14H20BO4S- — CID 174776083
[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfinate (PubChem CID 174776083) has the molecular formula C14H20BO4S- and a molecular weight of 295.19 g/mol. Its IUPAC name is [2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfinate.
| Compound Name | [2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174776083 |
| Molecular Formula | C14H20BO4S- |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfinate |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1CS(=O)[O-] |
| InChI | InChI=1S/C14H21BO4S/c1-10-8-12(7-6-11(10)9-20(16)17)15-18-13(2,3)14(4,5)19-15/h6-8H,9H2,1-5H3,(H,16,17)/p-1 |
| InChIKey | GVCMDRMMTAKRSL-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|