C16H26BNO3S — CID 164655579
N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfinamide (PubChem CID 164655579) has the molecular formula C16H26BNO3S and a molecular weight of 323.27 g/mol. Its IUPAC name is N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfinamide.
| Compound Name | N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 164655579 |
| Molecular Formula | C16H26BNO3S |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfinamide |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1NS(=O)C(C)C |
| InChI | InChI=1S/C16H26BNO3S/c1-11(2)22(19)18-14-9-8-13(10-12(14)3)17-20-15(4,5)16(6,7)21-17/h8-11,18H,1-7H3 |
| InChIKey | KSSZRBALLKYFLV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|