C14H21BO4S — CID 71237750
4,4,5,5-tetramethyl-2-(3-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane (PubChem CID 71237750) has the molecular formula C14H21BO4S and a molecular weight of 296.20 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(3-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(3-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 71237750 |
| Molecular Formula | C14H21BO4S |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(3-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H21BO4S/c1-10-9-11(7-8-12(10)20(6,16)17)15-18-13(2,3)14(4,5)19-15/h7-9H,1-6H3 |
| InChIKey | QWFFEUGDAKZCAC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|