C20H26BNO4S — CID 169370628
4-methyl-N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide (PubChem CID 169370628) has the molecular formula C20H26BNO4S and a molecular weight of 387.31 g/mol. Its IUPAC name is 4-methyl-N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 169370628 |
| Molecular Formula | C20H26BNO4S |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-methyl-N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(B3OC(C)(C)C(C)(C)O3)ccc2C)cc1 |
| InChI | InChI=1S/C20H26BNO4S/c1-14-7-11-17(12-8-14)27(23,24)22-18-13-16(10-9-15(18)2)21-25-19(3,4)20(5,6)26-21/h7-13,22H,1-6H3 |
| InChIKey | DRONUMPTGBYFQN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|