C19H22BF2NO4S — CID 164769176
2-fluoro-N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-methylbenzenesulfonamide (PubChem CID 164769176) has the molecular formula C19H22BF2NO4S and a molecular weight of 409.26 g/mol. Its IUPAC name is 2-fluoro-N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-methylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164769176 |
| Molecular Formula | C19H22BF2NO4S |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-fluoro-N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)c(S(=O)(=O)Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)c1 |
| InChI | InChI=1S/C19H22BF2NO4S/c1-12-6-8-14(21)17(10-12)28(24,25)23-16-9-7-13(11-15(16)22)20-26-18(2,3)19(4,5)27-20/h6-11,23H,1-5H3 |
| InChIKey | BXLGZQBWLKORRJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|