C19H20BF4NO4S — CID 164885254
N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 164885254) has the molecular formula C19H20BF4NO4S and a molecular weight of 445.24 g/mol. Its IUPAC name is N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 164885254 |
| Molecular Formula | C19H20BF4NO4S |
| Molecular Weight | 445.24 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC1(C)OB(c2ccc(NS(=O)(=O)c3ccccc3C(F)(F)F)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C19H20BF4NO4S/c1-17(2)18(3,4)29-20(28-17)12-9-10-15(14(21)11-12)25-30(26,27)16-8-6-5-7-13(16)19(22,23)24/h5-11,25H,1-4H3 |
| InChIKey | DLIRSVNRMSHXAO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|