C19H21BFNO4 — CID 100913429
phenyl N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 100913429) has the molecular formula C19H21BFNO4 and a molecular weight of 357.19 g/mol. Its IUPAC name is phenyl N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | phenyl N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 100913429 |
| Molecular Formula | C19H21BFNO4 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | phenyl N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | CC1(C)OB(c2ccc(NC(=O)Oc3ccccc3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C19H21BFNO4/c1-18(2)19(3,4)26-20(25-18)13-10-11-16(15(21)12-13)22-17(23)24-14-8-6-5-7-9-14/h5-12H,1-4H3,(H,22,23) |
| InChIKey | SGAPTSMRSFLJCU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|