C12H18BFN2O2 — CID 75487385
[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hydrazine (PubChem CID 75487385) has the molecular formula C12H18BFN2O2 and a molecular weight of 252.10 g/mol. Its IUPAC name is [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hydrazine.
| Compound Name | [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hydrazine |
|---|---|
| PubChem CID | 75487385 |
| Molecular Formula | C12H18BFN2O2 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]hydrazine |
| SMILES | CC1(C)OB(c2ccc(NN)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C12H18BFN2O2/c1-11(2)12(3,4)18-13(17-11)8-5-6-10(16-15)9(14)7-8/h5-7,16H,15H2,1-4H3 |
| InChIKey | MOILQTRVHZHRIF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|