C14H22BClFNO2 — CID 119031387
1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride (PubChem CID 119031387) has the molecular formula C14H22BClFNO2 and a molecular weight of 301.60 g/mol. Its IUPAC name is 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride.
| Compound Name | 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119031387 |
| Molecular Formula | C14H22BClFNO2 |
| Molecular Weight | 301.60 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride |
| SMILES | CC(N)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1F.Cl |
| InChI | InChI=1S/C14H21BFNO2.ClH/c1-9(17)11-7-6-10(8-12(11)16)15-18-13(2,3)14(4,5)19-15;/h6-9H,17H2,1-5H3;1H |
| InChIKey | SMULXKDNTGJNMJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|