C18H33BFO3P — CID 178024833
2-(4-dimethylphosphoryl-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane (PubChem CID 178024833) has the molecular formula C18H33BFO3P and a molecular weight of 358.24 g/mol. Its IUPAC name is 2-(4-dimethylphosphoryl-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane.
| Compound Name | 2-(4-dimethylphosphoryl-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
|---|---|
| PubChem CID | 178024833 |
| Molecular Formula | C18H33BFO3P |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 2-(4-dimethylphosphoryl-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
| SMILES | CC.CC.CC1(C)OB(c2ccc(P(C)(C)=O)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C14H21BFO3P.2C2H6/c1-13(2)14(3,4)19-15(18-13)10-7-8-12(11(16)9-10)20(5,6)17;2*1-2/h7-9H,1-6H3;2*1-2H3 |
| InChIKey | FIYYHWJAARTZTD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|