C13H20BClFNO2 — CID 75486703
2-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride (PubChem CID 75486703) has the molecular formula C13H20BClFNO2 and a molecular weight of 287.57 g/mol. Its IUPAC name is 2-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride.
| Compound Name | 2-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride |
|---|---|
| PubChem CID | 75486703 |
| Molecular Formula | C13H20BClFNO2 |
| Molecular Weight | 287.57 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-fluoro-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride |
| SMILES | CNc1ccc(B2OC(C)(C)C(C)(C)O2)cc1F.Cl |
| InChI | InChI=1S/C13H19BFNO2.ClH/c1-12(2)13(3,4)18-14(17-12)9-6-7-11(16-5)10(15)8-9;/h6-8,16H,1-5H3;1H |
| InChIKey | KAWTWYDMQNDSBR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|