C13H20BO5P — CID 154499375
[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphonic acid (PubChem CID 154499375) has the molecular formula C13H20BO5P and a molecular weight of 298.08 g/mol. Its IUPAC name is [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphonic acid.
| Compound Name | [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 154499375 |
| Molecular Formula | C13H20BO5P |
| Molecular Weight | 298.08 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphonic acid |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1P(=O)(O)O |
| InChI | InChI=1S/C13H20BO5P/c1-9-6-7-10(8-11(9)20(15,16)17)14-18-12(2,3)13(4,5)19-14/h6-8H,1-5H3,(H2,15,16,17) |
| InChIKey | LESSEYDELJCJKJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.08 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|