C32H40B2O4 — CID 164738613
2-[4-[2,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 164738613) has the molecular formula C32H40B2O4 and a molecular weight of 510.29 g/mol. Its IUPAC name is 2-[4-[2,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[2,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164738613 |
| Molecular Formula | C32H40B2O4 |
| Molecular Weight | 510.29 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 2-[4-[2,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c(C)cc1-c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C32H40B2O4/c1-21-19-28(24-13-17-26(18-14-24)34-37-31(7,8)32(9,10)38-34)22(2)20-27(21)23-11-15-25(16-12-23)33-35-29(3,4)30(5,6)36-33/h11-20H,1-10H3 |
| InChIKey | PKKHSGUXQOAXPB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.29 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|