C24H26BNO2 — CID 140838998
4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 140838998) has the molecular formula C24H26BNO2 and a molecular weight of 376.32 g/mol. Its IUPAC name is 4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 140838998 |
| Molecular Formula | C24H26BNO2 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cnc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2C)c([2H])c1[2H] |
| InChI | InChI=1S/C24H26BNO2/c1-17-15-22(26-16-21(17)18-9-7-6-8-10-18)19-11-13-20(14-12-19)25-27-23(2,3)24(4,5)28-25/h6-16H,1-5H3/i6D,7D,8D,9D,10D |
| InChIKey | UDDLSODBQAMWAZ-AITMVNPLSA-N |
| XLogP | 5.02 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|