C16H20BN3O2 — CID 67042001
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidin-2-amine (PubChem CID 67042001) has the molecular formula C16H20BN3O2 and a molecular weight of 297.17 g/mol. Its IUPAC name is 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 67042001 |
| Molecular Formula | C16H20BN3O2 |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidin-2-amine |
| SMILES | CC1(C)OB(c2ccc(-c3ccnc(N)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H20BN3O2/c1-15(2)16(3,4)22-17(21-15)12-7-5-11(6-8-12)13-9-10-19-14(18)20-13/h5-10H,1-4H3,(H2,18,19,20) |
| InChIKey | ZWVGFXNUJBXCHL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|