C16H22BN3O2 — CID 75486820
1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-5-amine (PubChem CID 75486820) has the molecular formula C16H22BN3O2 and a molecular weight of 299.18 g/mol. Its IUPAC name is 1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-5-amine.
| Compound Name | 1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 75486820 |
| Molecular Formula | C16H22BN3O2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-5-amine |
| SMILES | Cn1nc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1N |
| InChI | InChI=1S/C16H22BN3O2/c1-15(2)16(3,4)22-17(21-15)12-8-6-11(7-9-12)13-10-14(18)20(5)19-13/h6-10H,18H2,1-5H3 |
| InChIKey | RJIODSRBHXKYLG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|