C13H8Cl2F3NO2S — CID 18289032
N-(2,4-dichlorophenyl)-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 18289032) has the molecular formula C13H8Cl2F3NO2S and a molecular weight of 370.18 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18289032 |
| Molecular Formula | C13H8Cl2F3NO2S |
| Molecular Weight | 370.18 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1Cl)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H8Cl2F3NO2S/c14-8-5-6-11(10(15)7-8)19-22(20,21)12-4-2-1-3-9(12)13(16,17)18/h1-7,19H |
| InChIKey | XCVIQWDBCVRCAE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |