C14H8ClF6NO2S — CID 78787079
4-chloro-2-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 78787079) has the molecular formula C14H8ClF6NO2S and a molecular weight of 403.73 g/mol. Its IUPAC name is 4-chloro-2-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-2-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 78787079 |
| Molecular Formula | C14H8ClF6NO2S |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 4-chloro-2-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1C(F)(F)F)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C14H8ClF6NO2S/c15-8-5-6-12(10(7-8)14(19,20)21)25(23,24)22-11-4-2-1-3-9(11)13(16,17)18/h1-7,22H |
| InChIKey | YYASABYDMUFLSB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |