C14H9ClF3NO4S — CID 25335042
4-[[4-chloro-2-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 25335042) has the molecular formula C14H9ClF3NO4S and a molecular weight of 379.74 g/mol. Its IUPAC name is 4-[[4-chloro-2-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 4-[[4-chloro-2-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 25335042 |
| Molecular Formula | C14H9ClF3NO4S |
| Molecular Weight | 379.74 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 4-[[4-chloro-2-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2ccc(Cl)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H9ClF3NO4S/c15-9-3-6-12(11(7-9)14(16,17)18)24(22,23)19-10-4-1-8(2-5-10)13(20)21/h1-7,19H,(H,20,21) |
| InChIKey | RIUPGPXBFBRQMN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |