C16H18BClFN3O4S — CID 164580814
5-chloro-2-fluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]benzenesulfonamide (PubChem CID 164580814) has the molecular formula C16H18BClFN3O4S and a molecular weight of 413.67 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 164580814 |
| Molecular Formula | C16H18BClFN3O4S |
| Molecular Weight | 413.67 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 5-chloro-2-fluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]benzenesulfonamide |
| SMILES | CC1(C)OB(c2cnc(NS(=O)(=O)c3cc(Cl)ccc3F)nc2)OC1(C)C |
| InChI | InChI=1S/C16H18BClFN3O4S/c1-15(2)16(3,4)26-17(25-15)10-8-20-14(21-9-10)22-27(23,24)13-7-11(18)5-6-12(13)19/h5-9H,1-4H3,(H,20,21,22) |
| InChIKey | YHASWRFHPARQIW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.67 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|