C18H20BCl2NO4S — CID 86678947
2,5-dichloro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide (PubChem CID 86678947) has the molecular formula C18H20BCl2NO4S and a molecular weight of 428.15 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86678947 |
| Molecular Formula | C18H20BCl2NO4S |
| Molecular Weight | 428.15 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2,5-dichloro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide |
| SMILES | CC1(C)OB(c2ccc(NS(=O)(=O)c3cc(Cl)ccc3Cl)cc2)OC1(C)C |
| InChI | InChI=1S/C18H20BCl2NO4S/c1-17(2)18(3,4)26-19(25-17)12-5-8-14(9-6-12)22-27(23,24)16-11-13(20)7-10-15(16)21/h5-11,22H,1-4H3 |
| InChIKey | GRPNDXPBHBXFGR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.15 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|