C14H10Cl2N2O2S — CID 3841445
2,5-dichloro-N-[4-(cyanomethyl)phenyl]benzenesulfonamide (PubChem CID 3841445) has the molecular formula C14H10Cl2N2O2S and a molecular weight of 341.22 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-(cyanomethyl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[4-(cyanomethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3841445 |
| Molecular Formula | C14H10Cl2N2O2S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 2,5-dichloro-N-[4-(cyanomethyl)phenyl]benzenesulfonamide |
| SMILES | N#CCc1ccc(NS(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2N2O2S/c15-11-3-6-13(16)14(9-11)21(19,20)18-12-4-1-10(2-5-12)7-8-17/h1-6,9,18H,7H2 |
| InChIKey | FXBHMEPXOCQONM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |