C11H11N5O2S — CID 55056893
5-amino-N-[4-(cyanomethyl)phenyl]-1H-pyrazole-4-sulfonamide (PubChem CID 55056893) has the molecular formula C11H11N5O2S and a molecular weight of 277.31 g/mol. Its IUPAC name is 5-amino-N-[4-(cyanomethyl)phenyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-[4-(cyanomethyl)phenyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 55056893 |
| Molecular Formula | C11H11N5O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-amino-N-[4-(cyanomethyl)phenyl]-1H-pyrazole-4-sulfonamide |
| SMILES | N#CCc1ccc(NS(=O)(=O)c2cn[nH]c2N)cc1 |
| InChI | InChI=1S/C11H11N5O2S/c12-6-5-8-1-3-9(4-2-8)16-19(17,18)10-7-14-15-11(10)13/h1-4,7,16H,5H2,(H3,13,14,15) |
| InChIKey | HICUEEIPZKJNPE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |