C9H10N4O2S — CID 60812703
5-amino-N-phenyl-1H-pyrazole-4-sulfonamide (PubChem CID 60812703) has the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. Its IUPAC name is 5-amino-N-phenyl-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-phenyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60812703 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 5-amino-N-phenyl-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1[nH]ncc1S(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H10N4O2S/c10-9-8(6-11-12-9)16(14,15)13-7-4-2-1-3-5-7/h1-6,13H,(H3,10,11,12) |
| InChIKey | YUPVEZGXOJISSS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |