C9H8Br2N4O2S — CID 107596356
5-amino-N-(2,6-dibromophenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 107596356) has the molecular formula C9H8Br2N4O2S and a molecular weight of 396.06 g/mol. Its IUPAC name is 5-amino-N-(2,6-dibromophenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(2,6-dibromophenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 107596356 |
| Molecular Formula | C9H8Br2N4O2S |
| Molecular Weight | 396.06 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | 5-amino-N-(2,6-dibromophenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1[nH]ncc1S(=O)(=O)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C9H8Br2N4O2S/c10-5-2-1-3-6(11)8(5)15-18(16,17)7-4-13-14-9(7)12/h1-4,15H,(H3,12,13,14) |
| InChIKey | HXLCJBZWFZWCQR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.06 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |