C9H7Cl3N4O2S — CID 54922613
5-amino-N-(2,4,6-trichlorophenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 54922613) has the molecular formula C9H7Cl3N4O2S and a molecular weight of 341.61 g/mol. Its IUPAC name is 5-amino-N-(2,4,6-trichlorophenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(2,4,6-trichlorophenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 54922613 |
| Molecular Formula | C9H7Cl3N4O2S |
| Molecular Weight | 341.61 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | 5-amino-N-(2,4,6-trichlorophenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1[nH]ncc1S(=O)(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl3N4O2S/c10-4-1-5(11)8(6(12)2-4)16-19(17,18)7-3-14-15-9(7)13/h1-3,16H,(H3,13,14,15) |
| InChIKey | ASUIOQOBWFHQPX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |