C9H9ClN4O2S — CID 60812866
5-amino-N-(4-chlorophenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60812866) has the molecular formula C9H9ClN4O2S and a molecular weight of 272.72 g/mol. Its IUPAC name is 5-amino-N-(4-chlorophenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(4-chlorophenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60812866 |
| Molecular Formula | C9H9ClN4O2S |
| Molecular Weight | 272.72 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 5-amino-N-(4-chlorophenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1[nH]ncc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClN4O2S/c10-6-1-3-7(4-2-6)14-17(15,16)8-5-12-13-9(8)11/h1-5,14H,(H3,11,12,13) |
| InChIKey | HXHQLUGPZQNRCM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.72 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |