C9H11N5O4S2 — CID 60808929
5-amino-N-(3-sulfamoylphenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60808929) has the molecular formula C9H11N5O4S2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 5-amino-N-(3-sulfamoylphenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(3-sulfamoylphenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60808929 |
| Molecular Formula | C9H11N5O4S2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 5-amino-N-(3-sulfamoylphenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1[nH]ncc1S(=O)(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H11N5O4S2/c10-9-8(5-12-13-9)20(17,18)14-6-2-1-3-7(4-6)19(11,15)16/h1-5,14H,(H3,10,12,13)(H2,11,15,16) |
| InChIKey | RMPGCGSQGZOKRG-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 161.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |