C16H15N3O4S2 — CID 154848350
N-[3-(benzenesulfonyl)phenyl]-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 154848350) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)phenyl]-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[3-(benzenesulfonyl)phenyl]-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 154848350 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-[3-(benzenesulfonyl)phenyl]-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)Nc1cccc(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H15N3O4S2/c1-12-16(11-17-18-12)25(22,23)19-13-6-5-9-15(10-13)24(20,21)14-7-3-2-4-8-14/h2-11,19H,1H3,(H,17,18) |
| InChIKey | UKNQVVAUWIVNOE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |