C12H8Br3NO2S — CID 107602704
2-bromo-N-(2,6-dibromophenyl)benzenesulfonamide (PubChem CID 107602704) has the molecular formula C12H8Br3NO2S and a molecular weight of 469.98 g/mol. Its IUPAC name is 2-bromo-N-(2,6-dibromophenyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-(2,6-dibromophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107602704 |
| Molecular Formula | C12H8Br3NO2S |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 466.78 |
| IUPAC Name | 2-bromo-N-(2,6-dibromophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1c(Br)cccc1Br)c1ccccc1Br |
| InChI | InChI=1S/C12H8Br3NO2S/c13-8-4-1-2-7-11(8)19(17,18)16-12-9(14)5-3-6-10(12)15/h1-7,16H |
| InChIKey | XLGLUDPVKGXYKU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |