C12H8Br3NO3S — CID 81241100
2-hydroxy-N-(2,4,6-tribromophenyl)benzenesulfonamide (PubChem CID 81241100) has the molecular formula C12H8Br3NO3S and a molecular weight of 485.98 g/mol. Its IUPAC name is 2-hydroxy-N-(2,4,6-tribromophenyl)benzenesulfonamide.
| Compound Name | 2-hydroxy-N-(2,4,6-tribromophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81241100 |
| Molecular Formula | C12H8Br3NO3S |
| Molecular Weight | 485.98 g/mol |
| Exact Mass | 482.78 |
| IUPAC Name | 2-hydroxy-N-(2,4,6-tribromophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1c(Br)cc(Br)cc1Br)c1ccccc1O |
| InChI | InChI=1S/C12H8Br3NO3S/c13-7-5-8(14)12(9(15)6-7)16-20(18,19)11-4-2-1-3-10(11)17/h1-6,16-17H |
| InChIKey | YKISOIBJMYWJRO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |