C13H10Br2N2O3S — CID 155816192
2-(benzenesulfonamido)-3,5-dibromobenzamide (PubChem CID 155816192) has the molecular formula C13H10Br2N2O3S and a molecular weight of 434.11 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3,5-dibromobenzamide.
| Compound Name | 2-(benzenesulfonamido)-3,5-dibromobenzamide |
|---|---|
| PubChem CID | 155816192 |
| Molecular Formula | C13H10Br2N2O3S |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 431.88 |
| IUPAC Name | 2-(benzenesulfonamido)-3,5-dibromobenzamide |
| SMILES | NC(=O)c1cc(Br)cc(Br)c1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H10Br2N2O3S/c14-8-6-10(13(16)18)12(11(15)7-8)17-21(19,20)9-4-2-1-3-5-9/h1-7,17H,(H2,16,18) |
| InChIKey | IPAIOCBFUYVXJU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |