C15H15Br2NO3S — CID 100695379
N-[2,4-dibromo-6-(2-methoxyethyl)phenyl]benzenesulfonamide (PubChem CID 100695379) has the molecular formula C15H15Br2NO3S and a molecular weight of 449.16 g/mol. Its IUPAC name is N-[2,4-dibromo-6-(2-methoxyethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2,4-dibromo-6-(2-methoxyethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100695379 |
| Molecular Formula | C15H15Br2NO3S |
| Molecular Weight | 449.16 g/mol |
| Exact Mass | 446.91 |
| IUPAC Name | N-[2,4-dibromo-6-(2-methoxyethyl)phenyl]benzenesulfonamide |
| SMILES | COCCc1cc(Br)cc(Br)c1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H15Br2NO3S/c1-21-8-7-11-9-12(16)10-14(17)15(11)18-22(19,20)13-5-3-2-4-6-13/h2-6,9-10,18H,7-8H2,1H3 |
| InChIKey | HQYTYUHYCVJIOZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.16 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |