C19H16N2O3S — CID 70022066
2-(benzenesulfonamido)-4-phenylbenzamide (PubChem CID 70022066) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-4-phenylbenzamide.
| Compound Name | 2-(benzenesulfonamido)-4-phenylbenzamide |
|---|---|
| PubChem CID | 70022066 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-(benzenesulfonamido)-4-phenylbenzamide |
| SMILES | NC(=O)c1ccc(-c2ccccc2)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O3S/c20-19(22)17-12-11-15(14-7-3-1-4-8-14)13-18(17)21-25(23,24)16-9-5-2-6-10-16/h1-13,21H,(H2,20,22) |
| InChIKey | GRGQFGBHQOJZAP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |